About methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate
methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate (PubChem CID 35025922) has the molecular formula C16H14Cl2N4O3
and a molecular weight of 381.22 g/mol. Its IUPAC name is methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate |
| PubChem CID | 35025922 |
| Molecular Formula | C16H14Cl2N4O3 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)N(C#N)c1nc(C)cc(Oc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C16H14Cl2N4O3/c1-9-6-14(25-13-5-4-11(17)7-12(13)18)21-16(20-9)22(8-19)10(2)15(23)24-3/h4-7,10H,1-3H3/t10-/m1/s1 |
| InChIKey | HXMLNBKHQADIGZ-SNVBAGLBSA-N |
| XLogP | 3.73 |
| TPSA | 88.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate?
The IUPAC name of methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate (CID 35025922) is methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate.
What is the SMILES notation for methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate?
The canonical SMILES for methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate is COC(=O)[C@@H](C)N(C#N)c1nc(C)cc(Oc2ccc(Cl)cc2Cl)n1.
What is the InChIKey of methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate?
The InChIKey is HXMLNBKHQADIGZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H14Cl2N4O3/c1-9-6-14(25-13-5-4-11(17)7-12(13)18)21-16(20-9)22(8-19)10(2)15(23)24-3/h4-7,10H,1-3H3/t10-/m1/s1.
What are the key properties of methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate?
methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate has a molecular weight of 381.22 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[cyano-[4-(2,4-dichlorophenoxy)-6-methylpyrimidin-2-yl]amino]propanoate is sourced from PubChem (CID 35025922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).