C23H25NO5S — CID 35032199
4-[[[(3S)-1,1-dioxothiolan-3-yl]-[(4-methoxyphenyl)methyl]amino]methyl]-7-methylchromen-2-one (PubChem CID 35032199) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is 4-[[[(3S)-1,1-dioxothiolan-3-yl]-[(4-methoxyphenyl)methyl]amino]methyl]-7-methylchromen-2-one.
| Compound Name | 4-[[[(3S)-1,1-dioxothiolan-3-yl]-[(4-methoxyphenyl)methyl]amino]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 35032199 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-[[[(3S)-1,1-dioxothiolan-3-yl]-[(4-methoxyphenyl)methyl]amino]methyl]-7-methylchromen-2-one |
| SMILES | COc1ccc(CN(Cc2cc(=O)oc3cc(C)ccc23)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C23H25NO5S/c1-16-3-8-21-18(12-23(25)29-22(21)11-16)14-24(19-9-10-30(26,27)15-19)13-17-4-6-20(28-2)7-5-17/h3-8,11-12,19H,9-10,13-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | NGDPFSCREFKIPI-IBGZPJMESA-N |
| XLogP | 3.30 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|