C18H26ClN3 — CID 3503747
4-N-(5-chloroisoquinolin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 3503747) has the molecular formula C18H26ClN3 and a molecular weight of 319.88 g/mol. Its IUPAC name is 4-N-(5-chloroisoquinolin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | 4-N-(5-chloroisoquinolin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 3503747 |
| Molecular Formula | C18H26ClN3 |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-N-(5-chloroisoquinolin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1nccc2c(Cl)cccc12 |
| InChI | InChI=1S/C18H26ClN3/c1-4-22(5-2)13-7-8-14(3)21-18-16-9-6-10-17(19)15(16)11-12-20-18/h6,9-12,14H,4-5,7-8,13H2,1-3H3,(H,20,21) |
| InChIKey | XRTLIRBMJKGLAX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |