About N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine
N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine (PubChem CID 3504009) has the molecular formula C13H19BrN4O2
and a molecular weight of 343.23 g/mol. Its IUPAC name is N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine.
Molecular Properties
| Compound Name | N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine |
| PubChem CID | 3504009 |
| Molecular Formula | C13H19BrN4O2 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCN(CCOC)Cc1nc2ncccn2c1Br |
| InChI | InChI=1S/C13H19BrN4O2/c1-19-8-6-17(7-9-20-2)10-11-12(14)18-5-3-4-15-13(18)16-11/h3-5H,6-10H2,1-2H3 |
| InChIKey | LWJCLLIZGZHWJU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine?
The IUPAC name of N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine (CID 3504009) is N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine.
What is the SMILES notation for N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine?
The canonical SMILES for N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine is COCCN(CCOC)Cc1nc2ncccn2c1Br.
What is the InChIKey of N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine?
The InChIKey is LWJCLLIZGZHWJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrN4O2/c1-19-8-6-17(7-9-20-2)10-11-12(14)18-5-3-4-15-13(18)16-11/h3-5H,6-10H2,1-2H3.
What are the key properties of N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine?
N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine has a molecular weight of 343.23 g/mol, XLogP of 1.59, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-bromoimidazo[1,2-a]pyrimidin-2-yl)methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine is sourced from PubChem (CID 3504009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).