C20H18F2N2O2S — CID 3504168
Ethyl 6-(2,6-difluorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 3504168) has the molecular formula C20H18F2N2O2S and a molecular weight of 388.40 g/mol. Its IUPAC name is ethyl 6-(2,6-difluorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | Ethyl 6-(2,6-difluorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3504168 |
| Molecular Formula | C20H18F2N2O2S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | ethyl 6-(2,6-difluorophenyl)-4-methyl-3-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(N(C(=S)NC1C2=C(C=CC=C2F)F)C3=CC=CC=C3)C |
| InChI | InChI=1S/C20H18F2N2O2S/c1-3-26-19(25)16-12(2)24(13-8-5-4-6-9-13)20(27)23-18(16)17-14(21)10-7-11-15(17)22/h4-11,18H,3H2,1-2H3,(H,23,27) |
| InChIKey | UHHWFCPMVUBIIW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | 597 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|