C18H17N3O3S — CID 35041836
(2R)-2-(2-methoxyphenoxy)-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide (PubChem CID 35041836) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is (2R)-2-(2-methoxyphenoxy)-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide.
| Compound Name | (2R)-2-(2-methoxyphenoxy)-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 35041836 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (2R)-2-(2-methoxyphenoxy)-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide |
| SMILES | COc1ccccc1O[C@H](C)C(=O)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C18H17N3O3S/c1-12(24-15-11-7-6-10-14(15)23-2)17(22)20-18-19-16(21-25-18)13-8-4-3-5-9-13/h3-12H,1-2H3,(H,19,20,21,22)/t12-/m1/s1 |
| InChIKey | LOAGPBDATYDOPM-GFCCVEGCSA-N |
| XLogP | 3.62 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |