C25H25N3O4 — CID 35042084
(5R)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 35042084) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (5R)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 35042084 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (5R)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(O)=C2C(=O)C(=O)N(CCCn3ccnc3)[C@@H]2c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C25H25N3O4/c1-16-4-5-17(2)20(14-16)23(30)21-22(18-6-8-19(29)9-7-18)28(25(32)24(21)31)12-3-11-27-13-10-26-15-27/h4-10,13-15,22,29-30H,3,11-12H2,1-2H3/t22-/m1/s1 |
| InChIKey | DMPAODBEFBVVBM-JOCHJYFZSA-N |
| XLogP | 3.72 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|