C12H18N4S — CID 3504385
4-(1-methylpiperidin-3-yl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 3504385) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 4-(1-methylpiperidin-3-yl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-(1-methylpiperidin-3-yl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 3504385 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-(1-methylpiperidin-3-yl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | CN1CCCC(c2[nH]c(=S)nc3c2CCN3)C1 |
| InChI | InChI=1S/C12H18N4S/c1-16-6-2-3-8(7-16)10-9-4-5-13-11(9)15-12(17)14-10/h8H,2-7H2,1H3,(H2,13,14,15,17) |
| InChIKey | XEHKTICTEGSCPI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|