About 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide
2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide (PubChem CID 3504607) has the molecular formula C8H9ClF2N2O
and a molecular weight of 222.62 g/mol. Its IUPAC name is 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide |
| PubChem CID | 3504607 |
| Molecular Formula | C8H9ClF2N2O |
| Molecular Weight | 222.62 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide |
| SMILES | O=C(NCCn1cccc1)C(F)(F)Cl |
| InChI | InChI=1S/C8H9ClF2N2O/c9-8(10,11)7(14)12-3-6-13-4-1-2-5-13/h1-2,4-5H,3,6H2,(H,12,14) |
| InChIKey | SGHARDOHFRWYPK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.62 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide?
The IUPAC name of 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide (CID 3504607) is 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide.
What is the SMILES notation for 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide?
The canonical SMILES for 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide is O=C(NCCn1cccc1)C(F)(F)Cl.
What is the InChIKey of 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide?
The InChIKey is SGHARDOHFRWYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF2N2O/c9-8(10,11)7(14)12-3-6-13-4-1-2-5-13/h1-2,4-5H,3,6H2,(H,12,14).
What are the key properties of 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide?
2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide has a molecular weight of 222.62 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2,2-difluoro-N-(2-pyrrol-1-ylethyl)acetamide is sourced from PubChem (CID 3504607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).