C17H19N3O2S — CID 3504933
1-(4-pyridin-2-ylpiperazin-1-yl)-4-thiophen-2-ylbutane-1,4-dione (PubChem CID 3504933) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 1-(4-pyridin-2-ylpiperazin-1-yl)-4-thiophen-2-ylbutane-1,4-dione.
| Compound Name | 1-(4-pyridin-2-ylpiperazin-1-yl)-4-thiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 3504933 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(4-pyridin-2-ylpiperazin-1-yl)-4-thiophen-2-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCN(c2ccccn2)CC1)c1cccs1 |
| InChI | InChI=1S/C17H19N3O2S/c21-14(15-4-3-13-23-15)6-7-17(22)20-11-9-19(10-12-20)16-5-1-2-8-18-16/h1-5,8,13H,6-7,9-12H2 |
| InChIKey | OSIVCEAQSBFDBV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |