C18H17ClN2O5 — CID 3505157
ethyl 5-[[2-(2-aminobenzoyl)oxyacetyl]amino]-2-chlorobenzoate (PubChem CID 3505157) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is ethyl 5-[[2-(2-aminobenzoyl)oxyacetyl]amino]-2-chlorobenzoate.
| Compound Name | ethyl 5-[[2-(2-aminobenzoyl)oxyacetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 3505157 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | ethyl 5-[[2-(2-aminobenzoyl)oxyacetyl]amino]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)COC(=O)c2ccccc2N)ccc1Cl |
| InChI | InChI=1S/C18H17ClN2O5/c1-2-25-18(24)13-9-11(7-8-14(13)19)21-16(22)10-26-17(23)12-5-3-4-6-15(12)20/h3-9H,2,10,20H2,1H3,(H,21,22) |
| InChIKey | WOWNCHMAYYWZGB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|