C16H19NO2S — CID 35062256
N-(furan-2-ylmethyl)-2-(4-propan-2-ylphenyl)sulfanylacetamide (PubChem CID 35062256) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(4-propan-2-ylphenyl)sulfanylacetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(4-propan-2-ylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 35062256 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(4-propan-2-ylphenyl)sulfanylacetamide |
| SMILES | CC(C)c1ccc(SCC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H19NO2S/c1-12(2)13-5-7-15(8-6-13)20-11-16(18)17-10-14-4-3-9-19-14/h3-9,12H,10-11H2,1-2H3,(H,17,18) |
| InChIKey | GBFVMLPOYYHJIE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |