C49H60F2N2O4 — CID 3506387
1-(1-adamantylmethyl)-1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(1-phenylethyl)urea (PubChem CID 3506387) has the molecular formula C49H60F2N2O4 and a molecular weight of 779.02 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-(1-adamantylmethyl)-1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 3506387 |
| Molecular Formula | C49H60F2N2O4 |
| Molecular Weight | 779.02 g/mol |
| Exact Mass | 778.45 |
| IUPAC Name | 1-(1-adamantylmethyl)-1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(1-phenylethyl)urea |
| SMILES | CC(NC(=O)N(CC12CC3CC(CC(C3)C1)C2)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(F)c(F)c3)CC(O)CCC5(C)C4CCC21C)c1ccccc1 |
| InChI | InChI=1S/C49H60F2N2O4/c1-30(34-7-5-4-6-8-34)52-43(56)53(28-46-23-31-19-32(24-46)21-33(20-31)25-46)29-48(57)16-13-41-45(48,3)15-12-40-44(2)14-11-36(54)26-47(44)17-18-49(40,41)37(27-47)42(55)35-9-10-38(50)39(51)22-35/h4-10,17-18,22,27,30-33,36,40-41,54,57H,11-16,19-21,23-26,28-29H2,1-3H3,(H,52,56) |
| InChIKey | DITMHUKRUBRODH-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.02 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|