C17H22N2O — CID 3506875
4-methyl-N-(4-methylphenyl)-2-pyrrol-1-ylpentanamide (PubChem CID 3506875) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)-2-pyrrol-1-ylpentanamide.
| Compound Name | 4-methyl-N-(4-methylphenyl)-2-pyrrol-1-ylpentanamide |
|---|---|
| PubChem CID | 3506875 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)-2-pyrrol-1-ylpentanamide |
| SMILES | Cc1ccc(NC(=O)C(CC(C)C)n2cccc2)cc1 |
| InChI | InChI=1S/C17H22N2O/c1-13(2)12-16(19-10-4-5-11-19)17(20)18-15-8-6-14(3)7-9-15/h4-11,13,16H,12H2,1-3H3,(H,18,20) |
| InChIKey | CXJNWQHJACNKGL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |