C24H23N7O — CID 3507497
2-N-[(2-ethoxyphenyl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 3507497) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-N-[(2-ethoxyphenyl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(2-ethoxyphenyl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3507497 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-N-[(2-ethoxyphenyl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCOc1ccccc1C=NNc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C24H23N7O/c1-2-32-21-16-10-9-11-18(21)17-25-31-24-29-22(26-19-12-5-3-6-13-19)28-23(30-24)27-20-14-7-4-8-15-20/h3-17H,2H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | NHVSBZZENAFUNC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|