C23H20N2OS — CID 3507548
2-(N-methylanilino)-5,6-diphenyl-5,6-dihydro-1,3-thiazin-4-one (PubChem CID 3507548) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(N-methylanilino)-5,6-diphenyl-5,6-dihydro-1,3-thiazin-4-one.
| Compound Name | 2-(N-methylanilino)-5,6-diphenyl-5,6-dihydro-1,3-thiazin-4-one |
|---|---|
| PubChem CID | 3507548 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-(N-methylanilino)-5,6-diphenyl-5,6-dihydro-1,3-thiazin-4-one |
| SMILES | CN(C1=NC(=O)C(c2ccccc2)C(c2ccccc2)S1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2OS/c1-25(19-15-9-4-10-16-19)23-24-22(26)20(17-11-5-2-6-12-17)21(27-23)18-13-7-3-8-14-18/h2-16,20-21H,1H3 |
| InChIKey | FGCZHNAOOBAQQP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |