C39H44N2O6S — CID 3508171
1-(5-carboxypentyl)-2-[3-(7-diethylazaniumylidene-3-methyl-4-phenylchromen-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonate (PubChem CID 3508171) has the molecular formula C39H44N2O6S and a molecular weight of 668.86 g/mol. Its IUPAC name is 1-(5-carboxypentyl)-2-[3-(7-diethylazaniumylidene-3-methyl-4-phenylchromen-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonate.
| Compound Name | 1-(5-carboxypentyl)-2-[3-(7-diethylazaniumylidene-3-methyl-4-phenylchromen-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonate |
|---|---|
| PubChem CID | 3508171 |
| Molecular Formula | C39H44N2O6S |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | 1-(5-carboxypentyl)-2-[3-(7-diethylazaniumylidene-3-methyl-4-phenylchromen-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonate |
| SMILES | CC[N+](CC)=c1ccc2c(-c3ccccc3)c(C)c(C=CC=C3N(CCCCCC(=O)O)c4ccc(S(=O)(=O)[O-])cc4C3(C)C)oc-2c1 |
| InChI | InChI=1S/C39H44N2O6S/c1-6-40(7-2)29-20-22-31-35(25-29)47-34(27(3)38(31)28-15-10-8-11-16-28)17-14-18-36-39(4,5)32-26-30(48(44,45)46)21-23-33(32)41(36)24-13-9-12-19-37(42)43/h8,10-11,14-18,20-23,25-26H,6-7,9,12-13,19,24H2,1-5H3,(H-,42,43,44,45,46) |
| InChIKey | YWNYFNQFSHZTFP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|