C44H49ClFNO5 — CID 3508412
naphthalen-2-yl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate (PubChem CID 3508412) has the molecular formula C44H49ClFNO5 and a molecular weight of 726.33 g/mol. Its IUPAC name is naphthalen-2-yl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate.
| Compound Name | naphthalen-2-yl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 3508412 |
| Molecular Formula | C44H49ClFNO5 |
| Molecular Weight | 726.33 g/mol |
| Exact Mass | 725.33 |
| IUPAC Name | naphthalen-2-yl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C44H49ClFNO5/c1-4-23-47(42(50)52-34-18-16-31-10-5-6-11-32(31)26-34)28-44(51)22-20-38-35-19-15-30(24-33(48)17-14-29(2)9-8-21-43(38,44)3)25-36(35)41(49)27-37-39(45)12-7-13-40(37)46/h5-7,9-13,15-16,18-19,25-26,33,38,48,51H,4,8,14,17,20-24,27-28H2,1-3H3 |
| InChIKey | DPIGJXQTZVWTLT-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.33 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|