C21H24ClNO4S — CID 3508675
N-benzyl-2-(4-chloro-3-methylphenoxy)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 3508675) has the molecular formula C21H24ClNO4S and a molecular weight of 421.95 g/mol. Its IUPAC name is N-benzyl-2-(4-chloro-3-methylphenoxy)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | N-benzyl-2-(4-chloro-3-methylphenoxy)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 3508675 |
| Molecular Formula | C21H24ClNO4S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-benzyl-2-(4-chloro-3-methylphenoxy)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | Cc1cc(OC(C)C(=O)N(Cc2ccccc2)C2CCS(=O)(=O)C2)ccc1Cl |
| InChI | InChI=1S/C21H24ClNO4S/c1-15-12-19(8-9-20(15)22)27-16(2)21(24)23(13-17-6-4-3-5-7-17)18-10-11-28(25,26)14-18/h3-9,12,16,18H,10-11,13-14H2,1-2H3 |
| InChIKey | ONUSYDWYTKMDCD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |