About 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone (PubChem CID 3509434) has the molecular formula C23H28N2O2S
and a molecular weight of 396.56 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone |
| PubChem CID | 3509434 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone |
| SMILES | CC(C)(C)c1cc(C(=O)Cn2c(=S)[nH]c3ccccc32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H28N2O2S/c1-22(2,3)15-11-14(12-16(20(15)27)23(4,5)6)19(26)13-25-18-10-8-7-9-17(18)24-21(25)28/h7-12,27H,13H2,1-6H3,(H,24,28) |
| InChIKey | PURAXHGCYQTVKJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone?
The IUPAC name of 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone (CID 3509434) is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone.
What is the SMILES notation for 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone?
The canonical SMILES for 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone is CC(C)(C)c1cc(C(=O)Cn2c(=S)[nH]c3ccccc32)cc(C(C)(C)C)c1O.
What is the InChIKey of 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone?
The InChIKey is PURAXHGCYQTVKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O2S/c1-22(2,3)15-11-14(12-16(20(15)27)23(4,5)6)19(26)13-25-18-10-8-7-9-17(18)24-21(25)28/h7-12,27H,13H2,1-6H3,(H,24,28).
What are the key properties of 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone?
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone has a molecular weight of 396.56 g/mol, XLogP of 5.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-sulfanylidene-3H-benzimidazol-1-yl)ethanone is sourced from PubChem (CID 3509434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).