C18H12BrFN4O4 — CID 3511218
1-[[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-fluorophenyl)urea (PubChem CID 3511218) has the molecular formula C18H12BrFN4O4 and a molecular weight of 447.22 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 3511218 |
| Molecular Formula | C18H12BrFN4O4 |
| Molecular Weight | 447.22 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 1-[[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]-3-(4-fluorophenyl)urea |
| SMILES | O=C(N=Cc1c(O)n(-c2ccc(Br)cc2)c(=O)[nH]c1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H12BrFN4O4/c19-10-1-7-13(8-2-10)24-16(26)14(15(25)23-18(24)28)9-21-17(27)22-12-5-3-11(20)4-6-12/h1-9,26H,(H,22,27)(H,23,25,28) |
| InChIKey | FWCRRYVVPOBXFN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|