About 1,2-diphenyl-6,7-dihydro-5H-indol-4-one
1,2-diphenyl-6,7-dihydro-5H-indol-4-one (PubChem CID 3511336) has the molecular formula C20H17NO
and a molecular weight of 287.36 g/mol. Its IUPAC name is 1,2-diphenyl-6,7-dihydro-5H-indol-4-one.
Molecular Properties
| Compound Name | 1,2-diphenyl-6,7-dihydro-5H-indol-4-one |
| PubChem CID | 3511336 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1,2-diphenyl-6,7-dihydro-5H-indol-4-one |
| SMILES | O=C1CCCc2c1cc(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C20H17NO/c22-20-13-7-12-18-17(20)14-19(15-8-3-1-4-9-15)21(18)16-10-5-2-6-11-16/h1-6,8-11,14H,7,12-13H2 |
| InChIKey | BYDPATGSGNCVRY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenyl-6,7-dihydro-5H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenyl-6,7-dihydro-5H-indol-4-one?
The IUPAC name of 1,2-diphenyl-6,7-dihydro-5H-indol-4-one (CID 3511336) is 1,2-diphenyl-6,7-dihydro-5H-indol-4-one.
What is the SMILES notation for 1,2-diphenyl-6,7-dihydro-5H-indol-4-one?
The canonical SMILES for 1,2-diphenyl-6,7-dihydro-5H-indol-4-one is O=C1CCCc2c1cc(-c1ccccc1)n2-c1ccccc1.
What is the InChIKey of 1,2-diphenyl-6,7-dihydro-5H-indol-4-one?
The InChIKey is BYDPATGSGNCVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO/c22-20-13-7-12-18-17(20)14-19(15-8-3-1-4-9-15)21(18)16-10-5-2-6-11-16/h1-6,8-11,14H,7,12-13H2.
What are the key properties of 1,2-diphenyl-6,7-dihydro-5H-indol-4-one?
1,2-diphenyl-6,7-dihydro-5H-indol-4-one has a molecular weight of 287.36 g/mol, XLogP of 4.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenyl-6,7-dihydro-5H-indol-4-one is sourced from PubChem (CID 3511336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).