C19H14N4O5S2 — CID 35121361
N-[5-[1-cyano-2-(2-hydroxyphenyl)ethenyl]sulfonyl-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide (PubChem CID 35121361) has the molecular formula C19H14N4O5S2 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[5-[1-cyano-2-(2-hydroxyphenyl)ethenyl]sulfonyl-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[1-cyano-2-(2-hydroxyphenyl)ethenyl]sulfonyl-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 35121361 |
| Molecular Formula | C19H14N4O5S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | N-[5-[1-cyano-2-(2-hydroxyphenyl)ethenyl]sulfonyl-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(S(=O)(=O)C(C#N)=Cc3ccccc3O)s2)cc1 |
| InChI | InChI=1S/C19H14N4O5S2/c1-28-14-8-6-12(7-9-14)17(25)21-18-22-23-19(29-18)30(26,27)15(11-20)10-13-4-2-3-5-16(13)24/h2-10,24H,1H3,(H,21,22,25) |
| InChIKey | PEAWBZXPTNFBGU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|