C25H36O8 — CID 3512487
methyl 3,15-diacetyloxy-14-hydroxy-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 3512487) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is methyl 3,15-diacetyloxy-14-hydroxy-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl 3,15-diacetyloxy-14-hydroxy-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 3512487 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | methyl 3,15-diacetyloxy-14-hydroxy-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)C1CC(OC(C)=O)C2(O)C3CCC4CC(OC(C)=O)CCC4(C)C3C(=O)CC12C |
| InChI | InChI=1S/C25H36O8/c1-13(26)32-16-8-9-23(3)15(10-16)6-7-17-21(23)19(28)12-24(4)18(22(29)31-5)11-20(25(17,24)30)33-14(2)27/h15-18,20-21,30H,6-12H2,1-5H3 |
| InChIKey | ISPHXQUMAWDLMY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|