C19H23FN2O4 — CID 35128117
(2R)-2-(4-fluorophenoxy)-N-[(2S)-2-(furan-2-yl)-2-morpholin-4-ylethyl]propanamide (PubChem CID 35128117) has the molecular formula C19H23FN2O4 and a molecular weight of 362.40 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenoxy)-N-[(2S)-2-(furan-2-yl)-2-morpholin-4-ylethyl]propanamide.
| Compound Name | (2R)-2-(4-fluorophenoxy)-N-[(2S)-2-(furan-2-yl)-2-morpholin-4-ylethyl]propanamide |
|---|---|
| PubChem CID | 35128117 |
| Molecular Formula | C19H23FN2O4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (2R)-2-(4-fluorophenoxy)-N-[(2S)-2-(furan-2-yl)-2-morpholin-4-ylethyl]propanamide |
| SMILES | C[C@@H](Oc1ccc(F)cc1)C(=O)NC[C@@H](c1ccco1)N1CCOCC1 |
| InChI | InChI=1S/C19H23FN2O4/c1-14(26-16-6-4-15(20)5-7-16)19(23)21-13-17(18-3-2-10-25-18)22-8-11-24-12-9-22/h2-7,10,14,17H,8-9,11-13H2,1H3,(H,21,23)/t14-,17+/m1/s1 |
| InChIKey | LSYWUFJKTCJQMU-PBHICJAKSA-N |
| XLogP | 2.38 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |