C3H2F6N+ — CID 3513958
1,1,1,3,3,3-hexafluoropropan-2-ylideneazanium (PubChem CID 3513958) has the molecular formula C3H2F6N+ and a molecular weight of 166.04 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-ylideneazanium.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-ylideneazanium |
|---|---|
| PubChem CID | 3513958 |
| Molecular Formula | C3H2F6N+ |
| Molecular Weight | 166.04 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-ylideneazanium |
| SMILES | [NH2+]=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3HF6N/c4-2(5,6)1(10)3(7,8)9/h10H/p+1 |
| InChIKey | VVRCKMPEMSAMST-UHFFFAOYSA-O |
| XLogP | 0.31 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.04 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|