C24H20N6O8 — CID 3514578
2-(4-nitrophenoxy)-N-[[4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide (PubChem CID 3514578) has the molecular formula C24H20N6O8 and a molecular weight of 520.46 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N-[[4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-nitrophenoxy)-N-[[4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3514578 |
| Molecular Formula | C24H20N6O8 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 2-(4-nitrophenoxy)-N-[[4-[[[2-(4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NN=Cc1ccc(C=NNC(=O)COc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H20N6O8/c31-23(15-37-21-9-5-19(6-10-21)29(33)34)27-25-13-17-1-2-18(4-3-17)14-26-28-24(32)16-38-22-11-7-20(8-12-22)30(35)36/h1-14H,15-16H2,(H,27,31)(H,28,32) |
| InChIKey | WOOIWLUYLWLMEF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 187.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|