C20H26N4O3 — CID 35151780
2-(1-adamantyl)-N-[2-oxo-2-[2-(pyridine-3-carbonyl)hydrazinyl]ethyl]acetamide (PubChem CID 35151780) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-oxo-2-[2-(pyridine-3-carbonyl)hydrazinyl]ethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-oxo-2-[2-(pyridine-3-carbonyl)hydrazinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 35151780 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-oxo-2-[2-(pyridine-3-carbonyl)hydrazinyl]ethyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C20H26N4O3/c25-17(10-20-7-13-4-14(8-20)6-15(5-13)9-20)22-12-18(26)23-24-19(27)16-2-1-3-21-11-16/h1-3,11,13-15H,4-10,12H2,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | OVMMNMVMDJYCSK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|