C22H18N2O3S — CID 3515602
N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)benzamide (PubChem CID 3515602) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)benzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 3515602 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(-c2ccc(C(=O)Nc3nc4ccc(OC)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O3S/c1-26-17-9-7-15(8-10-17)14-3-5-16(6-4-14)21(25)24-22-23-19-12-11-18(27-2)13-20(19)28-22/h3-13H,1-2H3,(H,23,24,25) |
| InChIKey | TZEVGIDKVOIAOU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |