C18H26F3N3O2 — CID 35160115
N-(2-methylpropyl)-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetamide (PubChem CID 35160115) has the molecular formula C18H26F3N3O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-methylpropyl)-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 35160115 |
| Molecular Formula | C18H26F3N3O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-(2-methylpropyl)-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]acetamide |
| SMILES | CC(C)CNC(=O)CN1CCN(Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H26F3N3O2/c1-14(2)11-22-17(25)13-24-9-7-23(8-10-24)12-15-3-5-16(6-4-15)26-18(19,20)21/h3-6,14H,7-13H2,1-2H3,(H,22,25) |
| InChIKey | NHEQUVQSOIRLLL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |