C18H16N2O3 — CID 3516334
N-(4-cyanophenyl)-3-(2,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 3516334) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(2,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-cyanophenyl)-3-(2,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3516334 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(4-cyanophenyl)-3-(2,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2ccc(C#N)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H16N2O3/c1-22-16-9-5-14(17(11-16)23-2)6-10-18(21)20-15-7-3-13(12-19)4-8-15/h3-11H,1-2H3,(H,20,21) |
| InChIKey | HSZXTGIBVNRCMS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|