C22H23N3O4S2 — CID 3516389
2-[[3-(3-ethoxypropyl)-4-oxo-[1]benzothiolo[3,2-d]pyrimidin-2-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 3516389) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 2-[[3-(3-ethoxypropyl)-4-oxo-[1]benzothiolo[3,2-d]pyrimidin-2-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[3-(3-ethoxypropyl)-4-oxo-[1]benzothiolo[3,2-d]pyrimidin-2-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3516389 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-[[3-(3-ethoxypropyl)-4-oxo-[1]benzothiolo[3,2-d]pyrimidin-2-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCOCCCn1c(SCC(=O)NCc2ccco2)nc2c(sc3ccccc32)c1=O |
| InChI | InChI=1S/C22H23N3O4S2/c1-2-28-11-6-10-25-21(27)20-19(16-8-3-4-9-17(16)31-20)24-22(25)30-14-18(26)23-13-15-7-5-12-29-15/h3-5,7-9,12H,2,6,10-11,13-14H2,1H3,(H,23,26) |
| InChIKey | MFQZXYBMMXSVSL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|