About 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione
8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione (PubChem CID 3516530) has the molecular formula C22H19F3N4O4
and a molecular weight of 460.41 g/mol. Its IUPAC name is 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione |
| PubChem CID | 3516530 |
| Molecular Formula | C22H19F3N4O4 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione |
| SMILES | COc1cccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H19F3N4O4/c1-27-18-17(19(30)28(2)21(27)31)29(12-13-6-4-7-14(10-13)22(23,24)25)20(26-18)33-16-9-5-8-15(11-16)32-3/h4-11H,12H2,1-3H3 |
| InChIKey | MIBQYFUGUWUXHB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione?
The IUPAC name of 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione (CID 3516530) is 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione.
What is the SMILES notation for 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione?
The canonical SMILES for 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione is COc1cccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2cccc(C(F)(F)F)c2)c1.
What is the InChIKey of 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione?
The InChIKey is MIBQYFUGUWUXHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3N4O4/c1-27-18-17(19(30)28(2)21(27)31)29(12-13-6-4-7-14(10-13)22(23,24)25)20(26-18)33-16-9-5-8-15(11-16)32-3/h4-11H,12H2,1-3H3.
What are the key properties of 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione?
8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione has a molecular weight of 460.41 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-methoxyphenoxy)-1,3-dimethyl-7-[[3-(trifluoromethyl)phenyl]methyl]purine-2,6-dione is sourced from PubChem (CID 3516530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).