C21H15N3O7S2 — CID 3516579
methyl 2-[4-hydroxy-2-(4-nitrophenyl)-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3516579) has the molecular formula C21H15N3O7S2 and a molecular weight of 485.50 g/mol. Its IUPAC name is methyl 2-[4-hydroxy-2-(4-nitrophenyl)-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[4-hydroxy-2-(4-nitrophenyl)-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3516579 |
| Molecular Formula | C21H15N3O7S2 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | methyl 2-[4-hydroxy-2-(4-nitrophenyl)-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(O)=C(C(=O)c3cccs3)C2c2ccc([N+](=O)[O-])cc2)nc1C |
| InChI | InChI=1S/C21H15N3O7S2/c1-10-18(20(28)31-2)33-21(22-10)23-15(11-5-7-12(8-6-11)24(29)30)14(17(26)19(23)27)16(25)13-4-3-9-32-13/h3-9,15,26H,1-2H3 |
| InChIKey | MDMHVZGAIOZRMH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 139.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|