C12H19F3N4O3 — CID 35169808
1-[2-(2-acetylhydrazinyl)-2-oxoethyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 35169808) has the molecular formula C12H19F3N4O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is 1-[2-(2-acetylhydrazinyl)-2-oxoethyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(2-acetylhydrazinyl)-2-oxoethyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 35169808 |
| Molecular Formula | C12H19F3N4O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[2-(2-acetylhydrazinyl)-2-oxoethyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | CC(=O)NNC(=O)CN1CCC(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N4O3/c1-8(20)17-18-10(21)6-19-4-2-9(3-5-19)11(22)16-7-12(13,14)15/h9H,2-7H2,1H3,(H,16,22)(H,17,20)(H,18,21) |
| InChIKey | SYUSGDXZFBMLFG-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|