C26H24ClN5O2 — CID 3517124
1-(3-chlorophenyl)-3-[4-(diethylamino)phenyl]-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3517124) has the molecular formula C26H24ClN5O2 and a molecular weight of 473.96 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(diethylamino)phenyl]-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(diethylamino)phenyl]-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3517124 |
| Molecular Formula | C26H24ClN5O2 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(diethylamino)phenyl]-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3cccc(Cl)c3)OC(c3ccc(N(CC)CC)cc3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C26H24ClN5O2/c1-4-32(5-2)21-11-9-18(10-12-21)22-24(14-28,15-29)25(16-30)17(3)26(33-22,34-23(25)31)19-7-6-8-20(27)13-19/h6-13,17,22,31H,4-5H2,1-3H3/b31-23- |
| InChIKey | ANCFRYJXYOCDMU-SXBRIOAWSA-N |
| XLogP | 5.30 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|