About N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine
N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine (PubChem CID 3517139) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine.
Molecular Properties
| Compound Name | N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine |
| PubChem CID | 3517139 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine |
| SMILES | COc1cc(OC)nc(Oc2ccccc2/C=N/C(C)(C)C)n1 |
| InChI | InChI=1S/C17H21N3O3/c1-17(2,3)18-11-12-8-6-7-9-13(12)23-16-19-14(21-4)10-15(20-16)22-5/h6-11H,1-5H3/b18-11+ |
| InChIKey | FNESCVXLWSZICG-WOJGMQOQSA-N |
| XLogP | 3.50 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine?
The IUPAC name of N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine (CID 3517139) is N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine.
What is the SMILES notation for N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine?
The canonical SMILES for N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine is COc1cc(OC)nc(Oc2ccccc2/C=N/C(C)(C)C)n1.
What is the InChIKey of N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine?
The InChIKey is FNESCVXLWSZICG-WOJGMQOQSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-17(2,3)18-11-12-8-6-7-9-13(12)23-16-19-14(21-4)10-15(20-16)22-5/h6-11H,1-5H3/b18-11+.
What are the key properties of N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine?
N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine has a molecular weight of 315.37 g/mol, XLogP of 3.50, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine is sourced from PubChem (CID 3517139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).