About sodium benzotriazol-1-ide
sodium benzotriazol-1-ide (PubChem CID 3517935) has the molecular formula C6H4N3Na
and a molecular weight of 141.11 g/mol. Its IUPAC name is sodium benzotriazol-1-ide.
Molecular Properties
| Compound Name | sodium benzotriazol-1-ide |
| PubChem CID | 3517935 |
| Molecular Formula | C6H4N3Na |
| Molecular Weight | 141.11 g/mol |
| Exact Mass | 141.03 |
| IUPAC Name | sodium benzotriazol-1-ide |
| SMILES | [Na+].c1ccc2[n-]nnc2c1 |
| InChI | InChI=1S/C6H4N3.Na/c1-2-4-6-5(3-1)7-9-8-6;/h1-4H;/q-1;+1 |
| InChIKey | POCQWBKETUXWSC-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.11 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium benzotriazol-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium benzotriazol-1-ide?
The IUPAC name of sodium benzotriazol-1-ide (CID 3517935) is sodium benzotriazol-1-ide.
What is the SMILES notation for sodium benzotriazol-1-ide?
The canonical SMILES for sodium benzotriazol-1-ide is [Na+].c1ccc2[n-]nnc2c1.
What is the InChIKey of sodium benzotriazol-1-ide?
The InChIKey is POCQWBKETUXWSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3.Na/c1-2-4-6-5(3-1)7-9-8-6;/h1-4H;/q-1;+1.
What are the key properties of sodium benzotriazol-1-ide?
sodium benzotriazol-1-ide has a molecular weight of 141.11 g/mol, XLogP of -2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium benzotriazol-1-ide is sourced from PubChem (CID 3517935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).