C25H22ClN3O — CID 35179994
(4R)-4-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]-1-(2-methylphenyl)pyrrolidin-2-one (PubChem CID 35179994) has the molecular formula C25H22ClN3O and a molecular weight of 415.92 g/mol. Its IUPAC name is (4R)-4-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]-1-(2-methylphenyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]-1-(2-methylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 35179994 |
| Molecular Formula | C25H22ClN3O |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (4R)-4-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]-1-(2-methylphenyl)pyrrolidin-2-one |
| SMILES | Cc1ccccc1N1C[C@H](c2nc3ccccc3n2Cc2cccc(Cl)c2)CC1=O |
| InChI | InChI=1S/C25H22ClN3O/c1-17-7-2-4-11-22(17)28-16-19(14-24(28)30)25-27-21-10-3-5-12-23(21)29(25)15-18-8-6-9-20(26)13-18/h2-13,19H,14-16H2,1H3/t19-/m1/s1 |
| InChIKey | SWMSFVRYIREHDY-LJQANCHMSA-N |
| XLogP | 5.57 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |