C19H18N6 — CID 35181905
6-(4-phenylpiperazin-1-yl)-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 35181905) has the molecular formula C19H18N6 and a molecular weight of 330.40 g/mol. Its IUPAC name is 6-(4-phenylpiperazin-1-yl)-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 6-(4-phenylpiperazin-1-yl)-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 35181905 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 6-(4-phenylpiperazin-1-yl)-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | c1ccc(N2CCN(c3nn4cnnc4c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C19H18N6/c1-2-6-15(7-3-1)23-10-12-24(13-11-23)19-17-9-5-4-8-16(17)18-21-20-14-25(18)22-19/h1-9,14H,10-13H2 |
| InChIKey | PLFXTEOZCHAFPB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |