About 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one
1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 35187304) has the molecular formula C20H24N6O2
and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 35187304 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1ccccc1N1CCN(C(=O)CCn2cnc3c(cnn3C)c2=O)CC1 |
| InChI | InChI=1S/C20H24N6O2/c1-15-5-3-4-6-17(15)24-9-11-25(12-10-24)18(27)7-8-26-14-21-19-16(20(26)28)13-22-23(19)2/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | LPIKVZMYFXLOAV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one (CID 35187304) is 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one is Cc1ccccc1N1CCN(C(=O)CCn2cnc3c(cnn3C)c2=O)CC1.
What is the InChIKey of 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is LPIKVZMYFXLOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6O2/c1-15-5-3-4-6-17(15)24-9-11-25(12-10-24)18(27)7-8-26-14-21-19-16(20(26)28)13-22-23(19)2/h3-6,13-14H,7-12H2,1-2H3.
What are the key properties of 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one?
1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 380.45 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-[3-[4-(2-methylphenyl)piperazin-1-yl]-3-oxopropyl]pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 35187304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).