About 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal
3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal (PubChem CID 3519541) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal.
Molecular Properties
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal |
| PubChem CID | 3519541 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30O2/c1-17(2,3)14-9-13(11-19(7,8)12-20)10-15(16(14)21)18(4,5)6/h9-10,12,21H,11H2,1-8H3 |
| InChIKey | XGWATTXMMMANFJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal?
The IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal (CID 3519541) is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal.
What is the SMILES notation for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal?
The canonical SMILES for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal is CC(C)(C=O)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal?
The InChIKey is XGWATTXMMMANFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2/c1-17(2,3)14-9-13(11-19(7,8)12-20)10-15(16(14)21)18(4,5)6/h9-10,12,21H,11H2,1-8H3.
What are the key properties of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal?
3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal has a molecular weight of 290.45 g/mol, XLogP of 4.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-dimethylpropanal is sourced from PubChem (CID 3519541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).