C19H22FNO2 — CID 3519554
6,7-diethoxy-1-(4-fluorophenyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 3519554) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 6,7-diethoxy-1-(4-fluorophenyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6,7-diethoxy-1-(4-fluorophenyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 3519554 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 6,7-diethoxy-1-(4-fluorophenyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCOc1cc2c(cc1OCC)C(c1ccc(F)cc1)NCC2 |
| InChI | InChI=1S/C19H22FNO2/c1-3-22-17-11-14-9-10-21-19(13-5-7-15(20)8-6-13)16(14)12-18(17)23-4-2/h5-8,11-12,19,21H,3-4,9-10H2,1-2H3 |
| InChIKey | OZUNBSWLBHFONJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |