About 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone
1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone (PubChem CID 3519950) has the molecular formula C20H16ClN3OS
and a molecular weight of 381.89 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone |
| PubChem CID | 3519950 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C(c2cccs2)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H16ClN3OS/c1-14(25)19-22-24(16-8-3-2-4-9-16)20(18-11-6-12-26-18)23(19)17-10-5-7-15(21)13-17/h2-13,20H,1H3 |
| InChIKey | QITGZKSVNRCXIT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone?
The IUPAC name of 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone (CID 3519950) is 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone.
What is the SMILES notation for 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone?
The canonical SMILES for 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone is CC(=O)C1=NN(c2ccccc2)C(c2cccs2)N1c1cccc(Cl)c1.
What is the InChIKey of 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone?
The InChIKey is QITGZKSVNRCXIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3OS/c1-14(25)19-22-24(16-8-3-2-4-9-16)20(18-11-6-12-26-18)23(19)17-10-5-7-15(21)13-17/h2-13,20H,1H3.
What are the key properties of 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone?
1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone has a molecular weight of 381.89 g/mol, XLogP of 5.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-chlorophenyl)-2-phenyl-3-thiophen-2-yl-3H-1,2,4-triazol-5-yl]ethanone is sourced from PubChem (CID 3519950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).