C24H31N2O5P — CID 3520152
1-benzoyl-N-[4-(diethoxyphosphorylmethyl)phenyl]piperidine-4-carboxamide (PubChem CID 3520152) has the molecular formula C24H31N2O5P and a molecular weight of 458.50 g/mol. Its IUPAC name is 1-benzoyl-N-[4-(diethoxyphosphorylmethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-[4-(diethoxyphosphorylmethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3520152 |
| Molecular Formula | C24H31N2O5P |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-benzoyl-N-[4-(diethoxyphosphorylmethyl)phenyl]piperidine-4-carboxamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)C2CCN(C(=O)c3ccccc3)CC2)cc1)OCC |
| InChI | InChI=1S/C24H31N2O5P/c1-3-30-32(29,31-4-2)18-19-10-12-22(13-11-19)25-23(27)20-14-16-26(17-15-20)24(28)21-8-6-5-7-9-21/h5-13,20H,3-4,14-18H2,1-2H3,(H,25,27) |
| InChIKey | QWFHBJJHKRTJFB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|