About 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde
7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde (PubChem CID 3520232) has the molecular formula C12H12O5
and a molecular weight of 236.22 g/mol. Its IUPAC name is 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde.
Molecular Properties
| Compound Name | 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde |
| PubChem CID | 3520232 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde |
| SMILES | CC1=CC2=C(C=O)C(=O)C(C)(O)C(O)C2=CO1 |
| InChI | InChI=1S/C12H12O5/c1-6-3-7-8(4-13)10(14)12(2,16)11(15)9(7)5-17-6/h3-5,11,15-16H,1-2H3 |
| InChIKey | QVMUHZHZYCDMAI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde?
The IUPAC name of 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde (CID 3520232) is 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde.
What is the SMILES notation for 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde?
The canonical SMILES for 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde is CC1=CC2=C(C=O)C(=O)C(C)(O)C(O)C2=CO1.
What is the InChIKey of 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde?
The InChIKey is QVMUHZHZYCDMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O5/c1-6-3-7-8(4-13)10(14)12(2,16)11(15)9(7)5-17-6/h3-5,11,15-16H,1-2H3.
What are the key properties of 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde?
7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde has a molecular weight of 236.22 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromene-5-carbaldehyde is sourced from PubChem (CID 3520232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).