C20H22CuF14O4 — CID 3520361
copper;bis(1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one) (PubChem CID 3520361) has the molecular formula C20H22CuF14O4 and a molecular weight of 655.91 g/mol. Its IUPAC name is copper;bis(1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one).
| Compound Name | copper;bis(1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one) |
|---|---|
| PubChem CID | 3520361 |
| Molecular Formula | C20H22CuF14O4 |
| Molecular Weight | 655.91 g/mol |
| Exact Mass | 655.06 |
| IUPAC Name | copper;bis(1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one) |
| SMILES | CC(C)(C)C(O)=CC(=O)C(F)(F)C(F)(F)C(F)(F)F.CC(C)(C)C(O)=CC(=O)C(F)(F)C(F)(F)C(F)(F)F.[Cu] |
| InChI | InChI=1S/2C10H11F7O2.Cu/c2*1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;/h2*4,18H,1-3H3; |
| InChIKey | YEJUVOSNBPIDDY-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.91 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|