C21H16Cl2N2O3S — CID 3520901
(2-chlorophenyl) 2-[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylate (PubChem CID 3520901) has the molecular formula C21H16Cl2N2O3S and a molecular weight of 447.34 g/mol. Its IUPAC name is (2-chlorophenyl) 2-[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylate.
| Compound Name | (2-chlorophenyl) 2-[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 3520901 |
| Molecular Formula | C21H16Cl2N2O3S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | (2-chlorophenyl) 2-[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)CSc2ncccc2C(=O)Oc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O3S/c1-13-8-9-14(11-17(13)23)25-19(26)12-29-20-15(5-4-10-24-20)21(27)28-18-7-3-2-6-16(18)22/h2-11H,12H2,1H3,(H,25,26) |
| InChIKey | CGFDEQURXCPQLD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|