About 1-methyl-5H-pteridine-2,4,6-trione
1-methyl-5H-pteridine-2,4,6-trione (PubChem CID 3521017) has the molecular formula C7H6N4O3
and a molecular weight of 194.15 g/mol. Its IUPAC name is 1-methyl-5H-pteridine-2,4,6-trione.
Molecular Properties
| Compound Name | 1-methyl-5H-pteridine-2,4,6-trione |
| PubChem CID | 3521017 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-methyl-5H-pteridine-2,4,6-trione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(=O)cnc21 |
| InChI | InChI=1S/C7H6N4O3/c1-11-5-4(6(13)10-7(11)14)9-3(12)2-8-5/h2H,1H3,(H,9,12)(H,10,13,14) |
| InChIKey | LZCOBTLZNBLUIK-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-5H-pteridine-2,4,6-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5H-pteridine-2,4,6-trione?
The IUPAC name of 1-methyl-5H-pteridine-2,4,6-trione (CID 3521017) is 1-methyl-5H-pteridine-2,4,6-trione.
What is the SMILES notation for 1-methyl-5H-pteridine-2,4,6-trione?
The canonical SMILES for 1-methyl-5H-pteridine-2,4,6-trione is Cn1c(=O)[nH]c(=O)c2[nH]c(=O)cnc21.
What is the InChIKey of 1-methyl-5H-pteridine-2,4,6-trione?
The InChIKey is LZCOBTLZNBLUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O3/c1-11-5-4(6(13)10-7(11)14)9-3(12)2-8-5/h2H,1H3,(H,9,12)(H,10,13,14).
What are the key properties of 1-methyl-5H-pteridine-2,4,6-trione?
1-methyl-5H-pteridine-2,4,6-trione has a molecular weight of 194.15 g/mol, XLogP of -1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5H-pteridine-2,4,6-trione is sourced from PubChem (CID 3521017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).