C23H21N3O3S — CID 3521643
3-(1,3-benzodioxol-5-yl)-N-[2-(3,5-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]prop-2-enamide (PubChem CID 3521643) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-(3,5-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-(3,5-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3521643 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-(3,5-dimethylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(C)cc(-n2nc3c(c2NC(=O)C=Cc2ccc4c(c2)OCO4)CSC3)c1 |
| InChI | InChI=1S/C23H21N3O3S/c1-14-7-15(2)9-17(8-14)26-23(18-11-30-12-19(18)25-26)24-22(27)6-4-16-3-5-20-21(10-16)29-13-28-20/h3-10H,11-13H2,1-2H3,(H,24,27) |
| InChIKey | SQIVJWFGXPZMLK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_55_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|